C19H25N7O2 — CID 145069865
[3-[4-(2-hydroxypropan-2-yl)triazol-2-yl]piperidin-1-yl]-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methanone (PubChem CID 145069865) has the molecular formula C19H25N7O2 and a molecular weight of 383.46 g/mol. Its IUPAC name is [3-[4-(2-hydroxypropan-2-yl)triazol-2-yl]piperidin-1-yl]-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methanone.
| Compound Name | [3-[4-(2-hydroxypropan-2-yl)triazol-2-yl]piperidin-1-yl]-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methanone |
|---|---|
| PubChem CID | 145069865 |
| Molecular Formula | C19H25N7O2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [3-[4-(2-hydroxypropan-2-yl)triazol-2-yl]piperidin-1-yl]-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methanone |
| SMILES | [H]/N=C/C=N\Nc1ccccc1C(=O)N1CCCC(n2ncc(C(C)(C)O)n2)C1 |
| InChI | InChI=1S/C19H25N7O2/c1-19(2,28)17-12-22-26(24-17)14-6-5-11-25(13-14)18(27)15-7-3-4-8-16(15)23-21-10-9-20/h3-4,7-10,12,14,20,23,28H,5-6,11,13H2,1-2H3/b20-9+,21-10- |
| InChIKey | HGQWBQDZJMEPHP-MDNBKFGKSA-N |
| XLogP | 2.03 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|