C28H43N5O2S — CID 144789327
cyclobutyl-[2-[(6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidin-3-yl]-5-methyl-2,3-dihydro-1,3-thiazol-4-yl]methanone;ethane (PubChem CID 144789327) has the molecular formula C28H43N5O2S and a molecular weight of 513.75 g/mol. Its IUPAC name is cyclobutyl-[2-[(6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidin-3-yl]-5-methyl-2,3-dihydro-1,3-thiazol-4-yl]methanone;ethane.
| Compound Name | cyclobutyl-[2-[(6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidin-3-yl]-5-methyl-2,3-dihydro-1,3-thiazol-4-yl]methanone;ethane |
|---|---|
| PubChem CID | 144789327 |
| Molecular Formula | C28H43N5O2S |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | cyclobutyl-[2-[(6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidin-3-yl]-5-methyl-2,3-dihydro-1,3-thiazol-4-yl]methanone;ethane |
| SMILES | CC.CC.[H]/N=C/C=N\Nc1ccccc1C(=O)N1CC(C2NC(C(=O)C3CCC3)=C(C)S2)CC[C@H]1C |
| InChI | InChI=1S/C24H31N5O2S.2C2H6/c1-15-10-11-18(23-27-21(16(2)32-23)22(30)17-6-5-7-17)14-29(15)24(31)19-8-3-4-9-20(19)28-26-13-12-25;2*1-2/h3-4,8-9,12-13,15,17-18,23,25,27-28H,5-7,10-11,14H2,1-2H3;2*1-2H3/b25-12+,26-13-;;/t15-,18?,23?;;/m1../s1 |
| InChIKey | JNXDTJUXOYZJJU-IPYKGXBPSA-N |
| XLogP | 6.29 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|