C17H22N4O3 — CID 89369782
(6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-methylbenzoyl]-6-methylpiperidine-3-carboxylic acid (PubChem CID 89369782) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-methylbenzoyl]-6-methylpiperidine-3-carboxylic acid.
| Compound Name | (6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-methylbenzoyl]-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 89369782 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-methylbenzoyl]-6-methylpiperidine-3-carboxylic acid |
| SMILES | [H]/N=C/C=N\Nc1ccc(C)cc1C(=O)N1CC(C(=O)O)CC[C@H]1C |
| InChI | InChI=1S/C17H22N4O3/c1-11-3-6-15(20-19-8-7-18)14(9-11)16(22)21-10-13(17(23)24)5-4-12(21)2/h3,6-9,12-13,18,20H,4-5,10H2,1-2H3,(H,23,24)/b18-7+,19-8-/t12-,13?/m1/s1 |
| InChIKey | XFXBYUIQDSRYDP-YDWYCZOTSA-N |
| XLogP | 2.37 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|