C26H37N5O3 — CID 143688662
benzyl 4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-1,4-diazepane-1-carboxylate;ethane (PubChem CID 143688662) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is benzyl 4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-1,4-diazepane-1-carboxylate;ethane.
| Compound Name | benzyl 4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-1,4-diazepane-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143688662 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | benzyl 4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-1,4-diazepane-1-carboxylate;ethane |
| SMILES | CC.CC.[H]/N=C\C=N/Nc1ccccc1C(=O)N1CCCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N5O3.2C2H6/c23-11-12-24-25-20-10-5-4-9-19(20)21(28)26-13-6-14-27(16-15-26)22(29)30-17-18-7-2-1-3-8-18;2*1-2/h1-5,7-12,23,25H,6,13-17H2;2*1-2H3/b23-11-,24-12-;; |
| InChIKey | KGCVRGIYCOVXSR-JNTIRPJYSA-N |
| XLogP | 5.27 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|