C22H26FN7O2 — CID 163426922
[2-(5-fluoro-4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-[2-(2-iminoethylidene)hydrazinyl]-4-methoxyphenyl]methanone (PubChem CID 163426922) has the molecular formula C22H26FN7O2 and a molecular weight of 439.50 g/mol. Its IUPAC name is [2-(5-fluoro-4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-[2-(2-iminoethylidene)hydrazinyl]-4-methoxyphenyl]methanone.
| Compound Name | [2-(5-fluoro-4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-[2-(2-iminoethylidene)hydrazinyl]-4-methoxyphenyl]methanone |
|---|---|
| PubChem CID | 163426922 |
| Molecular Formula | C22H26FN7O2 |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [2-(5-fluoro-4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-[2-(2-iminoethylidene)hydrazinyl]-4-methoxyphenyl]methanone |
| SMILES | [H]/N=C/C=NNc1cc(OC)ccc1C(=O)N1CC2CN(c3nc(C)c(F)c(C)n3)CC2C1 |
| InChI | InChI=1S/C22H26FN7O2/c1-13-20(23)14(2)27-22(26-13)30-11-15-9-29(10-16(15)12-30)21(31)18-5-4-17(32-3)8-19(18)28-25-7-6-24/h4-8,15-16,24,28H,9-12H2,1-3H3/b24-6+,25-7? |
| InChIKey | ANIGLPFDWAGZRW-RJOVFXNUSA-N |
| XLogP | 2.50 |
| TPSA | 106.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|