C17H18ClN3O5 — CID 146099516
methyl (E)-4-[[4-(5-chloro-1,3-benzoxazol-2-yl)morpholin-2-yl]methylamino]-4-oxobut-2-enoate (PubChem CID 146099516) has the molecular formula C17H18ClN3O5 and a molecular weight of 379.80 g/mol. Its IUPAC name is methyl (E)-4-[[4-(5-chloro-1,3-benzoxazol-2-yl)morpholin-2-yl]methylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[[4-(5-chloro-1,3-benzoxazol-2-yl)morpholin-2-yl]methylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 146099516 |
| Molecular Formula | C17H18ClN3O5 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | methyl (E)-4-[[4-(5-chloro-1,3-benzoxazol-2-yl)morpholin-2-yl]methylamino]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)NCC1CN(c2nc3cc(Cl)ccc3o2)CCO1 |
| InChI | InChI=1S/C17H18ClN3O5/c1-24-16(23)5-4-15(22)19-9-12-10-21(6-7-25-12)17-20-13-8-11(18)2-3-14(13)26-17/h2-5,8,12H,6-7,9-10H2,1H3,(H,19,22)/b5-4+ |
| InChIKey | CSBQNQALWXDDTG-SNAWJCMRSA-N |
| XLogP | 1.53 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|