C20H28ClN3O5 — CID 163333712
1-(5-chloro-1,3-benzoxazol-2-yl)-N-(1-ethoxy-2-methylpropan-2-yl)piperidine-3-carboxamide;formic acid (PubChem CID 163333712) has the molecular formula C20H28ClN3O5 and a molecular weight of 425.91 g/mol. Its IUPAC name is 1-(5-chloro-1,3-benzoxazol-2-yl)-N-(1-ethoxy-2-methylpropan-2-yl)piperidine-3-carboxamide;formic acid.
| Compound Name | 1-(5-chloro-1,3-benzoxazol-2-yl)-N-(1-ethoxy-2-methylpropan-2-yl)piperidine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 163333712 |
| Molecular Formula | C20H28ClN3O5 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 1-(5-chloro-1,3-benzoxazol-2-yl)-N-(1-ethoxy-2-methylpropan-2-yl)piperidine-3-carboxamide;formic acid |
| SMILES | CCOCC(C)(C)NC(=O)C1CCCN(c2nc3cc(Cl)ccc3o2)C1.O=CO |
| InChI | InChI=1S/C19H26ClN3O3.CH2O2/c1-4-25-12-19(2,3)22-17(24)13-6-5-9-23(11-13)18-21-15-10-14(20)7-8-16(15)26-18;2-1-3/h7-8,10,13H,4-6,9,11-12H2,1-3H3,(H,22,24);1H,(H,2,3) |
| InChIKey | WPCUEESVJDBRAJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|