C30H27BrN2O6 — CID 129180116
methyl (1R,8R,9S,10R)-8-(4-bromophenyl)-1,11-dihydroxy-4-[(4-methoxyphenyl)methyl]-9-phenyl-7-oxa-3,4-diazatricyclo[6.2.1.02,6]undeca-2,5-diene-10-carboxylate (PubChem CID 129180116) has the molecular formula C30H27BrN2O6 and a molecular weight of 591.46 g/mol. Its IUPAC name is methyl (1R,8R,9S,10R)-8-(4-bromophenyl)-1,11-dihydroxy-4-[(4-methoxyphenyl)methyl]-9-phenyl-7-oxa-3,4-diazatricyclo[6.2.1.02,6]undeca-2,5-diene-10-carboxylate.
| Compound Name | methyl (1R,8R,9S,10R)-8-(4-bromophenyl)-1,11-dihydroxy-4-[(4-methoxyphenyl)methyl]-9-phenyl-7-oxa-3,4-diazatricyclo[6.2.1.02,6]undeca-2,5-diene-10-carboxylate |
|---|---|
| PubChem CID | 129180116 |
| Molecular Formula | C30H27BrN2O6 |
| Molecular Weight | 591.46 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | methyl (1R,8R,9S,10R)-8-(4-bromophenyl)-1,11-dihydroxy-4-[(4-methoxyphenyl)methyl]-9-phenyl-7-oxa-3,4-diazatricyclo[6.2.1.02,6]undeca-2,5-diene-10-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)[C@]2(c3ccc(Br)cc3)Oc3cn(Cc4ccc(OC)cc4)nc3[C@@]1(O)C2O |
| InChI | InChI=1S/C30H27BrN2O6/c1-37-22-14-8-18(9-15-22)16-33-17-23-26(32-33)29(36)25(27(34)38-2)24(19-6-4-3-5-7-19)30(39-23,28(29)35)20-10-12-21(31)13-11-20/h3-15,17,24-25,28,35-36H,16H2,1-2H3/t24-,25+,28?,29-,30+/m1/s1 |
| InChIKey | IKZISMHTOQTMLX-LGJFGDNBSA-N |
| XLogP | 4.13 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |