C27H28O13 — CID 129184884
(2R)-2-[(2S)-2-acetyloxy-4-[[(1S,5R,13R,17R)-10,17-dihydroxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraen-14-yl]oxy]-4-oxobutanoyl]oxybutanedioic acid (PubChem CID 129184884) has the molecular formula C27H28O13 and a molecular weight of 560.51 g/mol. Its IUPAC name is (2R)-2-[(2S)-2-acetyloxy-4-[[(1S,5R,13R,17R)-10,17-dihydroxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraen-14-yl]oxy]-4-oxobutanoyl]oxybutanedioic acid.
| Compound Name | (2R)-2-[(2S)-2-acetyloxy-4-[[(1S,5R,13R,17R)-10,17-dihydroxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraen-14-yl]oxy]-4-oxobutanoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 129184884 |
| Molecular Formula | C27H28O13 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | (2R)-2-[(2S)-2-acetyloxy-4-[[(1S,5R,13R,17R)-10,17-dihydroxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraen-14-yl]oxy]-4-oxobutanoyl]oxybutanedioic acid |
| SMILES | CC(=O)O[C@@H](CC(=O)OC1=CC[C@@]2(O)[C@@H]3CCC[C@@]24c2c(ccc(O)c2O[C@@H]14)C3)C(=O)O[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H28O13/c1-12(28)37-18(25(35)39-17(24(33)34)10-19(30)31)11-20(32)38-16-6-8-27(36)14-3-2-7-26(27)21-13(9-14)4-5-15(29)22(21)40-23(16)26/h4-6,14,17-18,23,29,36H,2-3,7-11H2,1H3,(H,30,31)(H,33,34)/t14-,17-,18+,23+,26+,27-/m1/s1 |
| InChIKey | NQNDDPRWACBVJH-SKDUSROPSA-N |
| XLogP | 1.10 |
| TPSA | 203.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|