C6H9NO4 — CID 129184948
(2R)-2-amino-3-(1,3-dioxolan-2-yl)-3-oxopropanal (PubChem CID 129184948) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is (2R)-2-amino-3-(1,3-dioxolan-2-yl)-3-oxopropanal.
| Compound Name | (2R)-2-amino-3-(1,3-dioxolan-2-yl)-3-oxopropanal |
|---|---|
| PubChem CID | 129184948 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (2R)-2-amino-3-(1,3-dioxolan-2-yl)-3-oxopropanal |
| SMILES | N[C@H](C=O)C(=O)C1OCCO1 |
| InChI | InChI=1S/C6H9NO4/c7-4(3-8)5(9)6-10-1-2-11-6/h3-4,6H,1-2,7H2/t4-/m1/s1 |
| InChIKey | RAYMDRHYZBBFHN-SCSAIBSYSA-N |
| XLogP | -1.55 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|