C14H12Br2FNO2 — CID 129188268
2,3-dibromo-5-[3-fluoro-2-(1-methoxyethyl)phenoxy]pyridine (PubChem CID 129188268) has the molecular formula C14H12Br2FNO2 and a molecular weight of 405.06 g/mol. Its IUPAC name is 2,3-dibromo-5-[3-fluoro-2-(1-methoxyethyl)phenoxy]pyridine.
| Compound Name | 2,3-dibromo-5-[3-fluoro-2-(1-methoxyethyl)phenoxy]pyridine |
|---|---|
| PubChem CID | 129188268 |
| Molecular Formula | C14H12Br2FNO2 |
| Molecular Weight | 405.06 g/mol |
| Exact Mass | 402.92 |
| IUPAC Name | 2,3-dibromo-5-[3-fluoro-2-(1-methoxyethyl)phenoxy]pyridine |
| SMILES | COC(C)c1c(F)cccc1Oc1cnc(Br)c(Br)c1 |
| InChI | InChI=1S/C14H12Br2FNO2/c1-8(19-2)13-11(17)4-3-5-12(13)20-9-6-10(15)14(16)18-7-9/h3-8H,1-2H3 |
| InChIKey | MMOMSSAPCJZZIB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.06 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|