C14H24I2N2 — CID 129190769
1-[(3S,4S)-4-ethyl-3,5-diiodo-2,3-dimethylheptan-2-yl]imidazole (PubChem CID 129190769) has the molecular formula C14H24I2N2 and a molecular weight of 474.17 g/mol. Its IUPAC name is 1-[(3S,4S)-4-ethyl-3,5-diiodo-2,3-dimethylheptan-2-yl]imidazole.
| Compound Name | 1-[(3S,4S)-4-ethyl-3,5-diiodo-2,3-dimethylheptan-2-yl]imidazole |
|---|---|
| PubChem CID | 129190769 |
| Molecular Formula | C14H24I2N2 |
| Molecular Weight | 474.17 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | 1-[(3S,4S)-4-ethyl-3,5-diiodo-2,3-dimethylheptan-2-yl]imidazole |
| SMILES | CCC(I)[C@H](CC)[C@](C)(I)C(C)(C)n1ccnc1 |
| InChI | InChI=1S/C14H24I2N2/c1-6-11(12(15)7-2)14(5,16)13(3,4)18-9-8-17-10-18/h8-12H,6-7H2,1-5H3/t11-,12?,14-/m0/s1 |
| InChIKey | FGPHDUPCYNMUAR-PSIKVXPXSA-N |
| XLogP | 5.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.17 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|