About 2-methylbutane;1-methylimidazole
2-methylbutane;1-methylimidazole (PubChem CID 126686522) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-methylbutane;1-methylimidazole.
Molecular Properties
| Compound Name | 2-methylbutane;1-methylimidazole |
| PubChem CID | 126686522 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-methylbutane;1-methylimidazole |
| SMILES | CCC(C)C.Cn1ccnc1 |
| InChI | InChI=1S/C5H12.C4H6N2/c1-4-5(2)3;1-6-3-2-5-4-6/h5H,4H2,1-3H3;2-4H,1H3 |
| InChIKey | JWMTVSHFHVLRPX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylbutane;1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;1-methylimidazole?
The IUPAC name of 2-methylbutane;1-methylimidazole (CID 126686522) is 2-methylbutane;1-methylimidazole.
What is the SMILES notation for 2-methylbutane;1-methylimidazole?
The canonical SMILES for 2-methylbutane;1-methylimidazole is CCC(C)C.Cn1ccnc1.
What is the InChIKey of 2-methylbutane;1-methylimidazole?
The InChIKey is JWMTVSHFHVLRPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.C4H6N2/c1-4-5(2)3;1-6-3-2-5-4-6/h5H,4H2,1-3H3;2-4H,1H3.
What are the key properties of 2-methylbutane;1-methylimidazole?
2-methylbutane;1-methylimidazole has a molecular weight of 154.26 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;1-methylimidazole is sourced from PubChem (CID 126686522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).