C32H54O2 — CID 129191218
(3S,10R,13S)-16-cyclobutyl-17-[(2S)-2-hydroxy-7-methyloctan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 129191218) has the molecular formula C32H54O2 and a molecular weight of 470.78 g/mol. Its IUPAC name is (3S,10R,13S)-16-cyclobutyl-17-[(2S)-2-hydroxy-7-methyloctan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13S)-16-cyclobutyl-17-[(2S)-2-hydroxy-7-methyloctan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 129191218 |
| Molecular Formula | C32H54O2 |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 470.41 |
| IUPAC Name | (3S,10R,13S)-16-cyclobutyl-17-[(2S)-2-hydroxy-7-methyloctan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCCCC(C)(O)C1C(C2CCC2)CC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H54O2/c1-21(2)9-6-7-16-32(5,34)29-26(22-10-8-11-22)20-28-25-13-12-23-19-24(33)14-17-30(23,3)27(25)15-18-31(28,29)4/h12,21-22,24-29,33-34H,6-11,13-20H2,1-5H3/t24-,25?,26?,27?,28?,29?,30-,31-,32?/m0/s1 |
| InChIKey | IVJWPQUZLDVVKN-KAVKBYPTSA-N |
| XLogP | 7.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|