C17H21N3O2S — CID 12919183
1-[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]oxy-3-(pyridin-3-ylmethylamino)propan-2-ol (PubChem CID 12919183) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]oxy-3-(pyridin-3-ylmethylamino)propan-2-ol.
| Compound Name | 1-[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]oxy-3-(pyridin-3-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 12919183 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]oxy-3-(pyridin-3-ylmethylamino)propan-2-ol |
| SMILES | OC(CNCc1cccnc1)CO/N=C1\CCCc2sccc21 |
| InChI | InChI=1S/C17H21N3O2S/c21-14(11-19-10-13-3-2-7-18-9-13)12-22-20-16-4-1-5-17-15(16)6-8-23-17/h2-3,6-9,14,19,21H,1,4-5,10-12H2/b20-16+ |
| InChIKey | GIKKCGZPWMAUQQ-CAPFRKAQSA-N |
| XLogP | 2.35 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|