C20H21N5O3S — CID 129192269
4-[[(1R)-2-amino-2-oxo-1-phenylmethoxyethyl]amino]-2-[(3-methyl-1,2-thiazol-5-yl)amino]benzamide (PubChem CID 129192269) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is 4-[[(1R)-2-amino-2-oxo-1-phenylmethoxyethyl]amino]-2-[(3-methyl-1,2-thiazol-5-yl)amino]benzamide.
| Compound Name | 4-[[(1R)-2-amino-2-oxo-1-phenylmethoxyethyl]amino]-2-[(3-methyl-1,2-thiazol-5-yl)amino]benzamide |
|---|---|
| PubChem CID | 129192269 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-[[(1R)-2-amino-2-oxo-1-phenylmethoxyethyl]amino]-2-[(3-methyl-1,2-thiazol-5-yl)amino]benzamide |
| SMILES | Cc1cc(Nc2cc(N[C@H](OCc3ccccc3)C(N)=O)ccc2C(N)=O)sn1 |
| InChI | InChI=1S/C20H21N5O3S/c1-12-9-17(29-25-12)24-16-10-14(7-8-15(16)18(21)26)23-20(19(22)27)28-11-13-5-3-2-4-6-13/h2-10,20,23-24H,11H2,1H3,(H2,21,26)(H2,22,27)/t20-/m1/s1 |
| InChIKey | OHOYJGLNGFOZDX-HXUWFJFHSA-N |
| XLogP | 2.73 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|