C6H7FN2O — CID 129192925
5-fluoro-1,2-dihydropyridine-3-carboxamide (PubChem CID 129192925) has the molecular formula C6H7FN2O and a molecular weight of 142.13 g/mol. Its IUPAC name is 5-fluoro-1,2-dihydropyridine-3-carboxamide.
| Compound Name | 5-fluoro-1,2-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 129192925 |
| Molecular Formula | C6H7FN2O |
| Molecular Weight | 142.13 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 5-fluoro-1,2-dihydropyridine-3-carboxamide |
| SMILES | NC(=O)C1=CC(F)=CNC1 |
| InChI | InChI=1S/C6H7FN2O/c7-5-1-4(6(8)10)2-9-3-5/h1,3,9H,2H2,(H2,8,10) |
| InChIKey | GCPYJDSFPGWZAA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.13 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |