C28H26F3NO2 — CID 129193008
(2E)-2-hydroxyimino-2-(2-methylphenyl)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethanone (PubChem CID 129193008) has the molecular formula C28H26F3NO2 and a molecular weight of 465.52 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-2-(2-methylphenyl)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethanone.
| Compound Name | (2E)-2-hydroxyimino-2-(2-methylphenyl)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethanone |
|---|---|
| PubChem CID | 129193008 |
| Molecular Formula | C28H26F3NO2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (2E)-2-hydroxyimino-2-(2-methylphenyl)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethanone |
| SMILES | CCCC1(CCC(F)(F)F)c2ccccc2-c2ccc(C(=O)/C(=N/O)c3ccccc3C)cc21 |
| InChI | InChI=1S/C28H26F3NO2/c1-3-14-27(15-16-28(29,30)31)23-11-7-6-10-21(23)22-13-12-19(17-24(22)27)26(33)25(32-34)20-9-5-4-8-18(20)2/h4-13,17,34H,3,14-16H2,1-2H3/b32-25+ |
| InChIKey | HJHCOJZMVXVTDT-WGPBWIAQSA-N |
| XLogP | 7.47 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|