C30H34Cl2N4 — CID 129193503
4-[1-butyl-5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]indol-3-yl]aniline (PubChem CID 129193503) has the molecular formula C30H34Cl2N4 and a molecular weight of 521.54 g/mol. Its IUPAC name is 4-[1-butyl-5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]indol-3-yl]aniline.
| Compound Name | 4-[1-butyl-5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]indol-3-yl]aniline |
|---|---|
| PubChem CID | 129193503 |
| Molecular Formula | C30H34Cl2N4 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 4-[1-butyl-5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]indol-3-yl]aniline |
| SMILES | CCCCn1cc(-c2ccc(N)cc2)c2cc(CN3CCN(Cc4c(Cl)cccc4Cl)CC3)ccc21 |
| InChI | InChI=1S/C30H34Cl2N4/c1-2-3-13-36-21-26(23-8-10-24(33)11-9-23)25-18-22(7-12-30(25)36)19-34-14-16-35(17-15-34)20-27-28(31)5-4-6-29(27)32/h4-12,18,21H,2-3,13-17,19-20,33H2,1H3 |
| InChIKey | DJCILOJLPPPSPH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 37.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|