C36H41Cl2FN4O — CID 158000235
5-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-(4-fluorophenyl)indol-1-yl]-1-piperidin-2-ylpentan-1-one (PubChem CID 158000235) has the molecular formula C36H41Cl2FN4O and a molecular weight of 635.66 g/mol. Its IUPAC name is 5-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-(4-fluorophenyl)indol-1-yl]-1-piperidin-2-ylpentan-1-one.
| Compound Name | 5-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-(4-fluorophenyl)indol-1-yl]-1-piperidin-2-ylpentan-1-one |
|---|---|
| PubChem CID | 158000235 |
| Molecular Formula | C36H41Cl2FN4O |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | 5-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-(4-fluorophenyl)indol-1-yl]-1-piperidin-2-ylpentan-1-one |
| SMILES | O=C(CCCCn1cc(-c2ccc(F)cc2)c2cc(CN3CCN(Cc4c(Cl)cccc4Cl)CC3)ccc21)C1CCCCN1 |
| InChI | InChI=1S/C36H41Cl2FN4O/c37-32-6-5-7-33(38)31(32)24-42-20-18-41(19-21-42)23-26-10-15-35-29(22-26)30(27-11-13-28(39)14-12-27)25-43(35)17-4-2-9-36(44)34-8-1-3-16-40-34/h5-7,10-15,22,25,34,40H,1-4,8-9,16-21,23-24H2 |
| InChIKey | OHDAFSDORHBFNB-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|