C19H25NO3 — CID 129193798
6,9a,11a-trimethyl-3,3a,3b,4,8,9,9b,11-octahydro-2H-indeno[5,4-f]quinoline-1,7,10-trione (PubChem CID 129193798) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 6,9a,11a-trimethyl-3,3a,3b,4,8,9,9b,11-octahydro-2H-indeno[5,4-f]quinoline-1,7,10-trione.
| Compound Name | 6,9a,11a-trimethyl-3,3a,3b,4,8,9,9b,11-octahydro-2H-indeno[5,4-f]quinoline-1,7,10-trione |
|---|---|
| PubChem CID | 129193798 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 6,9a,11a-trimethyl-3,3a,3b,4,8,9,9b,11-octahydro-2H-indeno[5,4-f]quinoline-1,7,10-trione |
| SMILES | CN1C(=O)CCC2(C)C1=CCC1C3CCC(=O)C3(C)CC(=O)C12 |
| InChI | InChI=1S/C19H25NO3/c1-18-9-8-16(23)20(3)14(18)6-4-11-12-5-7-15(22)19(12,2)10-13(21)17(11)18/h6,11-12,17H,4-5,7-10H2,1-3H3 |
| InChIKey | VVCDZYGSMZNKQY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |