C19H22F2O3 — CID 154174753
(8S,9S,10R,13S,14S)-4,4-difluoro-10,13-dimethyl-2,7,8,9,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,11,17-trione (PubChem CID 154174753) has the molecular formula C19H22F2O3 and a molecular weight of 336.38 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-4,4-difluoro-10,13-dimethyl-2,7,8,9,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,11,17-trione.
| Compound Name | (8S,9S,10R,13S,14S)-4,4-difluoro-10,13-dimethyl-2,7,8,9,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,11,17-trione |
|---|---|
| PubChem CID | 154174753 |
| Molecular Formula | C19H22F2O3 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (8S,9S,10R,13S,14S)-4,4-difluoro-10,13-dimethyl-2,7,8,9,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,11,17-trione |
| SMILES | C[C@]12CCC(=O)C(F)(F)C1=CC[C@@H]1[C@@H]2C(=O)C[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H22F2O3/c1-17-8-7-15(24)19(20,21)13(17)5-3-10-11-4-6-14(23)18(11,2)9-12(22)16(10)17/h5,10-11,16H,3-4,6-9H2,1-2H3/t10-,11-,16+,17-,18-/m0/s1 |
| InChIKey | PESXXJYFCGHCDR-GLOZSXEUSA-N |
| XLogP | 3.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|