C23H27FINO4S — CID 129195581
ethyl 2-[4-[(3-fluoro-2-methoxy-N-methylanilino)methyl]-2-iodosulfanyl-3,6-dimethyl-5-(2-oxoethyl)phenyl]acetate (PubChem CID 129195581) has the molecular formula C23H27FINO4S and a molecular weight of 559.44 g/mol. Its IUPAC name is ethyl 2-[4-[(3-fluoro-2-methoxy-N-methylanilino)methyl]-2-iodosulfanyl-3,6-dimethyl-5-(2-oxoethyl)phenyl]acetate.
| Compound Name | ethyl 2-[4-[(3-fluoro-2-methoxy-N-methylanilino)methyl]-2-iodosulfanyl-3,6-dimethyl-5-(2-oxoethyl)phenyl]acetate |
|---|---|
| PubChem CID | 129195581 |
| Molecular Formula | C23H27FINO4S |
| Molecular Weight | 559.44 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | ethyl 2-[4-[(3-fluoro-2-methoxy-N-methylanilino)methyl]-2-iodosulfanyl-3,6-dimethyl-5-(2-oxoethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(C)c(CC=O)c(CN(C)c2cccc(F)c2OC)c(C)c1SI |
| InChI | InChI=1S/C23H27FINO4S/c1-6-30-21(28)12-17-14(2)16(10-11-27)18(15(3)23(17)31-25)13-26(4)20-9-7-8-19(24)22(20)29-5/h7-9,11H,6,10,12-13H2,1-5H3 |
| InChIKey | XPEIKVMCCBDBCI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|