C23H38N2O10S — CID 129196550
5-[2-(2,5-dioxopyrrol-1-yl)-2-methylpropoxy]-1-[3-hydroxypropanoyl(methyl)amino]oxy-3,3,4,4,5-pentamethyl-1-oxohexane-2-sulfonic acid (PubChem CID 129196550) has the molecular formula C23H38N2O10S and a molecular weight of 534.63 g/mol. Its IUPAC name is 5-[2-(2,5-dioxopyrrol-1-yl)-2-methylpropoxy]-1-[3-hydroxypropanoyl(methyl)amino]oxy-3,3,4,4,5-pentamethyl-1-oxohexane-2-sulfonic acid.
| Compound Name | 5-[2-(2,5-dioxopyrrol-1-yl)-2-methylpropoxy]-1-[3-hydroxypropanoyl(methyl)amino]oxy-3,3,4,4,5-pentamethyl-1-oxohexane-2-sulfonic acid |
|---|---|
| PubChem CID | 129196550 |
| Molecular Formula | C23H38N2O10S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 5-[2-(2,5-dioxopyrrol-1-yl)-2-methylpropoxy]-1-[3-hydroxypropanoyl(methyl)amino]oxy-3,3,4,4,5-pentamethyl-1-oxohexane-2-sulfonic acid |
| SMILES | CN(OC(=O)C(C(C)(C)C(C)(C)C(C)(C)OCC(C)(C)N1C(=O)C=CC1=O)S(=O)(=O)O)C(=O)CCO |
| InChI | InChI=1S/C23H38N2O10S/c1-20(2,25-16(28)10-11-17(25)29)14-34-23(7,8)22(5,6)21(3,4)18(36(31,32)33)19(30)35-24(9)15(27)12-13-26/h10-11,18,26H,12-14H2,1-9H3,(H,31,32,33) |
| InChIKey | XAJRYCOZOPYDOD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|