About ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate
ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate (PubChem CID 129199172) has the molecular formula C17H17Cl2F3N2O3
and a molecular weight of 425.23 g/mol. Its IUPAC name is ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate |
| PubChem CID | 129199172 |
| Molecular Formula | C17H17Cl2F3N2O3 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate |
| SMILES | C=C(OCC)C1(C(F)(F)F)CC(C(=O)OCC)=NN1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2F3N2O3/c1-4-26-10(3)16(17(20,21)22)9-13(15(25)27-5-2)23-24(16)14-7-6-11(18)8-12(14)19/h6-8H,3-5,9H2,1-2H3 |
| InChIKey | XVGIHFGJCMYHHA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate?
The IUPAC name of ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate (CID 129199172) is ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate?
The canonical SMILES for ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate is C=C(OCC)C1(C(F)(F)F)CC(C(=O)OCC)=NN1c1ccc(Cl)cc1Cl.
What is the InChIKey of ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate?
The InChIKey is XVGIHFGJCMYHHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl2F3N2O3/c1-4-26-10(3)16(17(20,21)22)9-13(15(25)27-5-2)23-24(16)14-7-6-11(18)8-12(14)19/h6-8H,3-5,9H2,1-2H3.
What are the key properties of ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate?
ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate has a molecular weight of 425.23 g/mol, XLogP of 4.97, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,4-dichlorophenyl)-5-(1-ethoxyethenyl)-5-(trifluoromethyl)-4H-pyrazole-3-carboxylate is sourced from PubChem (CID 129199172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).