C22H24Cl2N2O3 — CID 23731045
ethyl 3-(4-butoxyphenyl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylate (PubChem CID 23731045) has the molecular formula C22H24Cl2N2O3 and a molecular weight of 435.35 g/mol. Its IUPAC name is ethyl 3-(4-butoxyphenyl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl 3-(4-butoxyphenyl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 23731045 |
| Molecular Formula | C22H24Cl2N2O3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | ethyl 3-(4-butoxyphenyl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCCCOc1ccc(C2CC(C(=O)OCC)=NN2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H24Cl2N2O3/c1-3-5-12-29-17-9-6-15(7-10-17)21-14-19(22(27)28-4-2)25-26(21)20-11-8-16(23)13-18(20)24/h6-11,13,21H,3-5,12,14H2,1-2H3 |
| InChIKey | PRTIWZLDGPJDFW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|