C23H27Cl3N4O — CID 143395110
3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-ethyl-N'-pentyl-3,4-dihydropyrazole-5-carbohydrazide (PubChem CID 143395110) has the molecular formula C23H27Cl3N4O and a molecular weight of 481.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-ethyl-N'-pentyl-3,4-dihydropyrazole-5-carbohydrazide.
| Compound Name | 3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-ethyl-N'-pentyl-3,4-dihydropyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 143395110 |
| Molecular Formula | C23H27Cl3N4O |
| Molecular Weight | 481.86 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-ethyl-N'-pentyl-3,4-dihydropyrazole-5-carbohydrazide |
| SMILES | CCCCCN(CC)NC(=O)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H27Cl3N4O/c1-3-5-6-13-29(4-2)28-23(31)20-15-22(16-7-9-17(24)10-8-16)30(27-20)21-12-11-18(25)14-19(21)26/h7-12,14,22H,3-6,13,15H2,1-2H3,(H,28,31) |
| InChIKey | ZMOPGCSRVNWDNS-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.86 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|