C22H25Cl3N4O4S — CID 87639880
(3S)-3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide;methanesulfonic acid (PubChem CID 87639880) has the molecular formula C22H25Cl3N4O4S and a molecular weight of 547.89 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide;methanesulfonic acid.
| Compound Name | (3S)-3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 87639880 |
| Molecular Formula | C22H25Cl3N4O4S |
| Molecular Weight | 547.89 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C(NN1CCCCC1)C1=NN(c2ccc(Cl)cc2Cl)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H21Cl3N4O.CH4O3S/c22-15-6-4-14(5-7-15)20-13-18(21(29)26-27-10-2-1-3-11-27)25-28(20)19-9-8-16(23)12-17(19)24;1-5(2,3)4/h4-9,12,20H,1-3,10-11,13H2,(H,26,29);1H3,(H,2,3,4)/t20-;/m0./s1 |
| InChIKey | VGPMGFHDPXZDSI-BDQAORGHSA-N |
| XLogP | 4.98 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.89 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|