C20H21Cl3N4O6S — CID 25047699
3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N-morpholin-4-yl-3,4-dihydropyrazole-5-carboxamide;sulfuric acid (PubChem CID 25047699) has the molecular formula C20H21Cl3N4O6S and a molecular weight of 551.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N-morpholin-4-yl-3,4-dihydropyrazole-5-carboxamide;sulfuric acid.
| Compound Name | 3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N-morpholin-4-yl-3,4-dihydropyrazole-5-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 25047699 |
| Molecular Formula | C20H21Cl3N4O6S |
| Molecular Weight | 551.84 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N-morpholin-4-yl-3,4-dihydropyrazole-5-carboxamide;sulfuric acid |
| SMILES | O=C(NN1CCOCC1)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1.O=S(=O)(O)O |
| InChI | InChI=1S/C20H19Cl3N4O2.H2O4S/c21-14-3-1-13(2-4-14)19-12-17(20(28)25-26-7-9-29-10-8-26)24-27(19)18-6-5-15(22)11-16(18)23;1-5(2,3)4/h1-6,11,19H,7-10,12H2,(H,25,28);(H2,1,2,3,4) |
| InChIKey | OBPAVQCOFPPHAN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|