C20H19BrCl2N4OS — CID 15952382
3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-N-morpholin-4-yl-3,4-dihydropyrazole-5-carbothioamide (PubChem CID 15952382) has the molecular formula C20H19BrCl2N4OS and a molecular weight of 514.28 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-N-morpholin-4-yl-3,4-dihydropyrazole-5-carbothioamide.
| Compound Name | 3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-N-morpholin-4-yl-3,4-dihydropyrazole-5-carbothioamide |
|---|---|
| PubChem CID | 15952382 |
| Molecular Formula | C20H19BrCl2N4OS |
| Molecular Weight | 514.28 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | 3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-N-morpholin-4-yl-3,4-dihydropyrazole-5-carbothioamide |
| SMILES | S=C(NN1CCOCC1)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C20H19BrCl2N4OS/c21-14-3-1-13(2-4-14)19-12-17(20(29)25-26-7-9-28-10-8-26)24-27(19)18-6-5-15(22)11-16(18)23/h1-6,11,19H,7-10,12H2,(H,25,29) |
| InChIKey | RNGGQMUDWBGXGE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.28 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|