C21H21Cl2FN4S — CID 15952294
2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carbothioamide (PubChem CID 15952294) has the molecular formula C21H21Cl2FN4S and a molecular weight of 451.40 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carbothioamide.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carbothioamide |
|---|---|
| PubChem CID | 15952294 |
| Molecular Formula | C21H21Cl2FN4S |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carbothioamide |
| SMILES | Fc1ccc(C2CC(C(=S)NN3CCCCC3)=NN2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H21Cl2FN4S/c22-15-6-9-19(17(23)12-15)28-20(14-4-7-16(24)8-5-14)13-18(25-28)21(29)26-27-10-2-1-3-11-27/h4-9,12,20H,1-3,10-11,13H2,(H,26,29) |
| InChIKey | WTLIMGJEAFMXBC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|