C21H23Cl2N5O — CID 89191488
(3R)-3-(4-aminophenyl)-2-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 89191488) has the molecular formula C21H23Cl2N5O and a molecular weight of 432.36 g/mol. Its IUPAC name is (3R)-3-(4-aminophenyl)-2-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3R)-3-(4-aminophenyl)-2-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 89191488 |
| Molecular Formula | C21H23Cl2N5O |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (3R)-3-(4-aminophenyl)-2-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | Nc1ccc([C@H]2CC(C(=O)NN3CCCCC3)=NN2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H23Cl2N5O/c22-15-6-9-19(17(23)12-15)28-20(14-4-7-16(24)8-5-14)13-18(25-28)21(29)26-27-10-2-1-3-11-27/h4-9,12,20H,1-3,10-11,13,24H2,(H,26,29)/t20-/m1/s1 |
| InChIKey | UEEKZOLATBTWFK-HXUWFJFHSA-N |
| XLogP | 4.40 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|