C15H17Cl2IN4O — CID 89378026
(3R)-2-(2,4-dichlorophenyl)-3-iodo-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 89378026) has the molecular formula C15H17Cl2IN4O and a molecular weight of 467.14 g/mol. Its IUPAC name is (3R)-2-(2,4-dichlorophenyl)-3-iodo-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3R)-2-(2,4-dichlorophenyl)-3-iodo-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 89378026 |
| Molecular Formula | C15H17Cl2IN4O |
| Molecular Weight | 467.14 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | (3R)-2-(2,4-dichlorophenyl)-3-iodo-N-piperidin-1-yl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | O=C(NN1CCCCC1)C1=NN(c2ccc(Cl)cc2Cl)[C@H](I)C1 |
| InChI | InChI=1S/C15H17Cl2IN4O/c16-10-4-5-13(11(17)8-10)22-14(18)9-12(19-22)15(23)20-21-6-2-1-3-7-21/h4-5,8,14H,1-3,6-7,9H2,(H,20,23)/t14-/m0/s1 |
| InChIKey | LBOLYKRMRMFLBZ-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.14 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|