C20H31NO2 — CID 129199662
(8R,9S,10R,13S,14R,17S)-14-amino-17-methoxy-10,13-dimethyl-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 129199662) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (8R,9S,10R,13S,14R,17S)-14-amino-17-methoxy-10,13-dimethyl-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14R,17S)-14-amino-17-methoxy-10,13-dimethyl-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129199662 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (8R,9S,10R,13S,14R,17S)-14-amino-17-methoxy-10,13-dimethyl-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CO[C@H]1CC[C@@]2(N)[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H31NO2/c1-18-9-6-14(22)12-13(18)4-5-16-15(18)7-10-19(2)17(23-3)8-11-20(16,19)21/h12,15-17H,4-11,21H2,1-3H3/t15-,16+,17-,18-,19+,20+/m0/s1 |
| InChIKey | GTCMEJUIKWRHLH-GNVSMLMZSA-N |
| XLogP | 3.61 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |