C49H31N5 — CID 129201394
5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-naphthalen-1-ylphenyl)phenyl]benzo[c][2,7]naphthyridine (PubChem CID 129201394) has the molecular formula C49H31N5 and a molecular weight of 689.82 g/mol. Its IUPAC name is 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-naphthalen-1-ylphenyl)phenyl]benzo[c][2,7]naphthyridine.
| Compound Name | 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-naphthalen-1-ylphenyl)phenyl]benzo[c][2,7]naphthyridine |
|---|---|
| PubChem CID | 129201394 |
| Molecular Formula | C49H31N5 |
| Molecular Weight | 689.82 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-naphthalen-1-ylphenyl)phenyl]benzo[c][2,7]naphthyridine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4ccc(-c5cccc6ccccc56)cc4)cc(-c4nc5ccccc5c5ccncc45)c3)n2)cc1 |
| InChI | InChI=1S/C49H31N5/c1-3-13-35(14-4-1)47-52-48(36-15-5-2-6-16-36)54-49(53-47)39-29-37(32-22-24-34(25-23-32)41-20-11-17-33-12-7-8-18-40(33)41)28-38(30-39)46-44-31-50-27-26-42(44)43-19-9-10-21-45(43)51-46/h1-31H |
| InChIKey | CQXPHPQOFRDYHB-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.82 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|