C20H28N2O4 — CID 129201904
N-(oxolan-3-ylmethyl)-5-(4-phenylmethoxybutyl)-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 129201904) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-5-(4-phenylmethoxybutyl)-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | N-(oxolan-3-ylmethyl)-5-(4-phenylmethoxybutyl)-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 129201904 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-5-(4-phenylmethoxybutyl)-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC1CCOC1)C1=NOC(CCCCOCc2ccccc2)C1 |
| InChI | InChI=1S/C20H28N2O4/c23-20(21-13-17-9-11-25-15-17)19-12-18(26-22-19)8-4-5-10-24-14-16-6-2-1-3-7-16/h1-3,6-7,17-18H,4-5,8-15H2,(H,21,23) |
| InChIKey | UBNZCJXBHBZXSL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|