C19H24N2O4 — CID 90325844
N-(oxolan-3-ylmethyl)-5-(4-phenoxybutyl)-1,2-oxazole-3-carboxamide (PubChem CID 90325844) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-5-(4-phenoxybutyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(oxolan-3-ylmethyl)-5-(4-phenoxybutyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90325844 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-5-(4-phenoxybutyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC1CCOC1)c1cc(CCCCOc2ccccc2)on1 |
| InChI | InChI=1S/C19H24N2O4/c22-19(20-13-15-9-11-23-14-15)18-12-17(25-21-18)8-4-5-10-24-16-6-2-1-3-7-16/h1-3,6-7,12,15H,4-5,8-11,13-14H2,(H,20,22) |
| InChIKey | VYGJZAFRBXLPGW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|