C22H29NO4 — CID 159638649
3-(oxolan-3-yl)-1-[5-(6-phenoxyhexyl)-1,2-oxazol-3-yl]propan-1-one (PubChem CID 159638649) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-1-[5-(6-phenoxyhexyl)-1,2-oxazol-3-yl]propan-1-one.
| Compound Name | 3-(oxolan-3-yl)-1-[5-(6-phenoxyhexyl)-1,2-oxazol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 159638649 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 3-(oxolan-3-yl)-1-[5-(6-phenoxyhexyl)-1,2-oxazol-3-yl]propan-1-one |
| SMILES | O=C(CCC1CCOC1)c1cc(CCCCCCOc2ccccc2)on1 |
| InChI | InChI=1S/C22H29NO4/c24-22(12-11-18-13-15-25-17-18)21-16-20(27-23-21)10-4-1-2-7-14-26-19-8-5-3-6-9-19/h3,5-6,8-9,16,18H,1-2,4,7,10-15,17H2 |
| InChIKey | MQBHOIQDFCWYHM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|