C23H31NO4 — CID 162007047
3-(oxan-4-yl)-1-[5-(5-phenylpentoxymethyl)-1,2-oxazol-3-yl]propan-1-one (PubChem CID 162007047) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 3-(oxan-4-yl)-1-[5-(5-phenylpentoxymethyl)-1,2-oxazol-3-yl]propan-1-one.
| Compound Name | 3-(oxan-4-yl)-1-[5-(5-phenylpentoxymethyl)-1,2-oxazol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 162007047 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 3-(oxan-4-yl)-1-[5-(5-phenylpentoxymethyl)-1,2-oxazol-3-yl]propan-1-one |
| SMILES | O=C(CCC1CCOCC1)c1cc(COCCCCCc2ccccc2)on1 |
| InChI | InChI=1S/C23H31NO4/c25-23(11-10-20-12-15-26-16-13-20)22-17-21(28-24-22)18-27-14-6-2-5-9-19-7-3-1-4-8-19/h1,3-4,7-8,17,20H,2,5-6,9-16,18H2 |
| InChIKey | YSYWLECJYGRGCH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|