C22H38N2O3 — CID 145008745
hexoxybenzene;(NE)-N-[1-(oxolan-3-ylmethylamino)pentan-3-ylidene]hydroxylamine (PubChem CID 145008745) has the molecular formula C22H38N2O3 and a molecular weight of 378.56 g/mol. Its IUPAC name is hexoxybenzene;(NE)-N-[1-(oxolan-3-ylmethylamino)pentan-3-ylidene]hydroxylamine.
| Compound Name | hexoxybenzene;(NE)-N-[1-(oxolan-3-ylmethylamino)pentan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 145008745 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | hexoxybenzene;(NE)-N-[1-(oxolan-3-ylmethylamino)pentan-3-ylidene]hydroxylamine |
| SMILES | CC/C(CCNCC1CCOC1)=N\O.CCCCCCOc1ccccc1 |
| InChI | InChI=1S/C12H18O.C10H20N2O2/c1-2-3-4-8-11-13-12-9-6-5-7-10-12;1-2-10(12-13)3-5-11-7-9-4-6-14-8-9/h5-7,9-10H,2-4,8,11H2,1H3;9,11,13H,2-8H2,1H3/b;12-10+ |
| InChIKey | XRBAOLLSBCVJGC-XIKQHSBTSA-N |
| XLogP | 4.89 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|