C16H27FN2O3S — CID 129202028
2-amino-5-butoxy-2-(2-fluorophenyl)-N-methylpentane-1-sulfonamide (PubChem CID 129202028) has the molecular formula C16H27FN2O3S and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-amino-5-butoxy-2-(2-fluorophenyl)-N-methylpentane-1-sulfonamide.
| Compound Name | 2-amino-5-butoxy-2-(2-fluorophenyl)-N-methylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 129202028 |
| Molecular Formula | C16H27FN2O3S |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-amino-5-butoxy-2-(2-fluorophenyl)-N-methylpentane-1-sulfonamide |
| SMILES | CCCCOCCCC(N)(CS(=O)(=O)NC)c1ccccc1F |
| InChI | InChI=1S/C16H27FN2O3S/c1-3-4-11-22-12-7-10-16(18,13-23(20,21)19-2)14-8-5-6-9-15(14)17/h5-6,8-9,19H,3-4,7,10-13,18H2,1-2H3 |
| InChIKey | DAJJLJIDKUHRCZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|