C17H28FN3O3S2 — CID 129202041
[5-butoxy-2-(2-fluorophenyl)-1-(methylsulfamoyl)pentan-2-yl]thiourea (PubChem CID 129202041) has the molecular formula C17H28FN3O3S2 and a molecular weight of 405.56 g/mol. Its IUPAC name is [5-butoxy-2-(2-fluorophenyl)-1-(methylsulfamoyl)pentan-2-yl]thiourea.
| Compound Name | [5-butoxy-2-(2-fluorophenyl)-1-(methylsulfamoyl)pentan-2-yl]thiourea |
|---|---|
| PubChem CID | 129202041 |
| Molecular Formula | C17H28FN3O3S2 |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [5-butoxy-2-(2-fluorophenyl)-1-(methylsulfamoyl)pentan-2-yl]thiourea |
| SMILES | CCCCOCCCC(CS(=O)(=O)NC)(NC(N)=S)c1ccccc1F |
| InChI | InChI=1S/C17H28FN3O3S2/c1-3-4-11-24-12-7-10-17(21-16(19)25,13-26(22,23)20-2)14-8-5-6-9-15(14)18/h5-6,8-9,20H,3-4,7,10-13H2,1-2H3,(H3,19,21,25) |
| InChIKey | NJINRGBYPGPOLI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|