C15H20FNOS — CID 129202531
(NE)-N-[1-(2-fluorophenyl)pent-4-enylidene]-2-methylpropane-2-sulfinamide (PubChem CID 129202531) has the molecular formula C15H20FNOS and a molecular weight of 281.40 g/mol. Its IUPAC name is (NE)-N-[1-(2-fluorophenyl)pent-4-enylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE)-N-[1-(2-fluorophenyl)pent-4-enylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 129202531 |
| Molecular Formula | C15H20FNOS |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (NE)-N-[1-(2-fluorophenyl)pent-4-enylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C=CCC/C(=N\S(=O)C(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C15H20FNOS/c1-5-6-11-14(17-19(18)15(2,3)4)12-9-7-8-10-13(12)16/h5,7-10H,1,6,11H2,2-4H3/b17-14+ |
| InChIKey | IFWRLNMGHPKPNY-SAPNQHFASA-N |
| XLogP | 4.04 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|