C23H26N2O6S — CID 129204756
(3S)-4-(cyclobutylsulfamoyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (PubChem CID 129204756) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is (3S)-4-(cyclobutylsulfamoyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid.
| Compound Name | (3S)-4-(cyclobutylsulfamoyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 129204756 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (3S)-4-(cyclobutylsulfamoyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(O)C[C@@H](CS(=O)(=O)NC1CCC1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H26N2O6S/c26-22(27)12-16(14-32(29,30)25-15-6-5-7-15)24-23(28)31-13-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-4,8-11,15-16,21,25H,5-7,12-14H2,(H,24,28)(H,26,27)/t16-/m0/s1 |
| InChIKey | GOZCPYSURQWAIS-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |