C29H41N3O — CID 129205025
N-[3-[5-ethyl-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrrolo[2,3-c]pyridin-1-yl]propyl]cyclononanecarboxamide (PubChem CID 129205025) has the molecular formula C29H41N3O and a molecular weight of 447.67 g/mol. Its IUPAC name is N-[3-[5-ethyl-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrrolo[2,3-c]pyridin-1-yl]propyl]cyclononanecarboxamide.
| Compound Name | N-[3-[5-ethyl-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrrolo[2,3-c]pyridin-1-yl]propyl]cyclononanecarboxamide |
|---|---|
| PubChem CID | 129205025 |
| Molecular Formula | C29H41N3O |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.32 |
| IUPAC Name | N-[3-[5-ethyl-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrrolo[2,3-c]pyridin-1-yl]propyl]cyclononanecarboxamide |
| SMILES | C=C/C(=C\C=C/C)c1cn(CCCNC(=O)C2CCCCCCCC2)c2cnc(CC)cc12 |
| InChI | InChI=1S/C29H41N3O/c1-4-7-15-23(5-2)27-22-32(28-21-31-25(6-3)20-26(27)28)19-14-18-30-29(33)24-16-12-10-8-9-11-13-17-24/h4-5,7,15,20-22,24H,2,6,8-14,16-19H2,1,3H3,(H,30,33)/b7-4-,23-15+ |
| InChIKey | MKNSFKYJUQZNNZ-IKDWJMPISA-N |
| XLogP | 7.00 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|