C22H29N3O2S — CID 91127252
N-[3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]cyclohexanecarboxamide (PubChem CID 91127252) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 91127252 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]cyclohexanecarboxamide |
| SMILES | CCc1ccccc1C(=O)c1cnc(NCCCNC(=O)C2CCCCC2)s1 |
| InChI | InChI=1S/C22H29N3O2S/c1-2-16-9-6-7-12-18(16)20(26)19-15-25-22(28-19)24-14-8-13-23-21(27)17-10-4-3-5-11-17/h6-7,9,12,15,17H,2-5,8,10-11,13-14H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | CYRHNDJEOHDEOK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|