C21H26N2O3S — CID 174464186
3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl cyclohexanecarboxylate (PubChem CID 174464186) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl cyclohexanecarboxylate.
| Compound Name | 3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 174464186 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl cyclohexanecarboxylate |
| SMILES | Cc1ccccc1C(=O)c1cnc(NCCCOC(=O)C2CCCCC2)s1 |
| InChI | InChI=1S/C21H26N2O3S/c1-15-8-5-6-11-17(15)19(24)18-14-23-21(27-18)22-12-7-13-26-20(25)16-9-3-2-4-10-16/h5-6,8,11,14,16H,2-4,7,9-10,12-13H2,1H3,(H,22,23) |
| InChIKey | OPJIYRNPTBZTFK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|