C22H24FN3O3S2 — CID 23442639
5-fluoro-N,2-dimethyl-N-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide (PubChem CID 23442639) has the molecular formula C22H24FN3O3S2 and a molecular weight of 461.58 g/mol. Its IUPAC name is 5-fluoro-N,2-dimethyl-N-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide.
| Compound Name | 5-fluoro-N,2-dimethyl-N-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23442639 |
| Molecular Formula | C22H24FN3O3S2 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 5-fluoro-N,2-dimethyl-N-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide |
| SMILES | Cc1ccccc1C(=O)c1cnc(NCCCN(C)S(=O)(=O)c2cc(F)ccc2C)s1 |
| InChI | InChI=1S/C22H24FN3O3S2/c1-15-7-4-5-8-18(15)21(27)19-14-25-22(30-19)24-11-6-12-26(3)31(28,29)20-13-17(23)10-9-16(20)2/h4-5,7-10,13-14H,6,11-12H2,1-3H3,(H,24,25) |
| InChIKey | OXTCHANQDNYNGK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|