C22H25N3O3S2 — CID 24887011
2-methyl-N-[3-[methyl-[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide (PubChem CID 24887011) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-methyl-N-[3-[methyl-[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide.
| Compound Name | 2-methyl-N-[3-[methyl-[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24887011 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-methyl-N-[3-[methyl-[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide |
| SMILES | Cc1ccccc1C(=O)c1cnc(N(C)CCCNS(=O)(=O)c2ccccc2C)s1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-16-9-4-6-11-18(16)21(26)19-15-23-22(29-19)25(3)14-8-13-24-30(27,28)20-12-7-5-10-17(20)2/h4-7,9-12,15,24H,8,13-14H2,1-3H3 |
| InChIKey | MGNGXPYDGYYIRF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|