C23H26FN3O3S2 — CID 23442503
5-fluoro-2-methyl-N-[5-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]pentyl]benzenesulfonamide (PubChem CID 23442503) has the molecular formula C23H26FN3O3S2 and a molecular weight of 475.61 g/mol. Its IUPAC name is 5-fluoro-2-methyl-N-[5-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]pentyl]benzenesulfonamide.
| Compound Name | 5-fluoro-2-methyl-N-[5-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]pentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23442503 |
| Molecular Formula | C23H26FN3O3S2 |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 5-fluoro-2-methyl-N-[5-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]pentyl]benzenesulfonamide |
| SMILES | Cc1ccccc1C(=O)c1cnc(NCCCCCNS(=O)(=O)c2cc(F)ccc2C)s1 |
| InChI | InChI=1S/C23H26FN3O3S2/c1-16-8-4-5-9-19(16)22(28)20-15-26-23(31-20)25-12-6-3-7-13-27-32(29,30)21-14-18(24)11-10-17(21)2/h4-5,8-11,14-15,27H,3,6-7,12-13H2,1-2H3,(H,25,26) |
| InChIKey | NMEFGKFQJFGAPI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|